C15H15N5O3 — CID 35418570
2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-3-methylquinazolin-4-one (PubChem CID 35418570) has the molecular formula C15H15N5O3 and a molecular weight of 313.32 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-3-methylquinazolin-4-one.
| Compound Name | 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-3-methylquinazolin-4-one |
|---|---|
| PubChem CID | 35418570 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-3-methylquinazolin-4-one |
| SMILES | Cc1nn(Cc2nc3ccccc3c(=O)n2C)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N5O3/c1-9-14(20(22)23)10(2)19(17-9)8-13-16-12-7-5-4-6-11(12)15(21)18(13)3/h4-7H,8H2,1-3H3 |
| InChIKey | QDYLFCSDSXOPMY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 95.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|