C20H16N6O5 — CID 19328341
5-[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 19328341) has the molecular formula C20H16N6O5 and a molecular weight of 420.39 g/mol. Its IUPAC name is 5-[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 19328341 |
| Molecular Formula | C20H16N6O5 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 5-[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | Cc1nn(Cc2ccc(-c3nc(-c4ccc([N+](=O)[O-])cc4)no3)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16N6O5/c1-12-18(26(29)30)13(2)24(22-12)11-14-3-5-16(6-4-14)20-21-19(23-31-20)15-7-9-17(10-8-15)25(27)28/h3-10H,11H2,1-2H3 |
| InChIKey | KHPMBONNMVYYAU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 143.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|