C20H16BrN5O3 — CID 19328276
5-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 19328276) has the molecular formula C20H16BrN5O3 and a molecular weight of 454.28 g/mol. Its IUPAC name is 5-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 19328276 |
| Molecular Formula | C20H16BrN5O3 |
| Molecular Weight | 454.28 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | 5-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-3-(4-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | Cc1nn(Cc2cccc(-c3nc(-c4ccc([N+](=O)[O-])cc4)no3)c2)c(C)c1Br |
| InChI | InChI=1S/C20H16BrN5O3/c1-12-18(21)13(2)25(23-12)11-14-4-3-5-16(10-14)20-22-19(24-29-20)15-6-8-17(9-7-15)26(27)28/h3-10H,11H2,1-2H3 |
| InChIKey | IOIAKSIQFUBEQU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 99.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.28 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|