C11H16N4O5 — CID 43469345
2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]butanoic acid (PubChem CID 43469345) has the molecular formula C11H16N4O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is 2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]butanoic acid.
| Compound Name | 2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43469345 |
| Molecular Formula | C11H16N4O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]butanoic acid |
| SMILES | CCC(NC(=O)Cn1nc(C)c([N+](=O)[O-])c1C)C(=O)O |
| InChI | InChI=1S/C11H16N4O5/c1-4-8(11(17)18)12-9(16)5-14-7(3)10(15(19)20)6(2)13-14/h8H,4-5H2,1-3H3,(H,12,16)(H,17,18) |
| InChIKey | NFPKWTSIBFJYNL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|