C29H25NO5 — CID 170882669
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[5-(3-methylphenyl)furan-2-yl]propanoic acid (PubChem CID 170882669) has the molecular formula C29H25NO5 and a molecular weight of 467.52 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[5-(3-methylphenyl)furan-2-yl]propanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[5-(3-methylphenyl)furan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 170882669 |
| Molecular Formula | C29H25NO5 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[5-(3-methylphenyl)furan-2-yl]propanoic acid |
| SMILES | Cc1cccc(-c2ccc(CC(NC(=O)OCC3c4ccccc4-c4ccccc43)C(=O)O)o2)c1 |
| InChI | InChI=1S/C29H25NO5/c1-18-7-6-8-19(15-18)27-14-13-20(35-27)16-26(28(31)32)30-29(33)34-17-25-23-11-4-2-9-21(23)22-10-3-5-12-24(22)25/h2-15,25-26H,16-17H2,1H3,(H,30,33)(H,31,32) |
| InChIKey | JRWZAOMCDRJCOM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |