C20H19BrClN3O3 — CID 17056447
N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine (PubChem CID 17056447) has the molecular formula C20H19BrClN3O3 and a molecular weight of 464.75 g/mol. Its IUPAC name is N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine.
| Compound Name | N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 17056447 |
| Molecular Formula | C20H19BrClN3O3 |
| Molecular Weight | 464.75 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]-N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine |
| SMILES | Cc1cc(Br)ccc1-c1ccc(CNCCNc2ccc([N+](=O)[O-])cc2Cl)o1 |
| InChI | InChI=1S/C20H19BrClN3O3/c1-13-10-14(21)2-5-17(13)20-7-4-16(28-20)12-23-8-9-24-19-6-3-15(25(26)27)11-18(19)22/h2-7,10-11,23-24H,8-9,12H2,1H3 |
| InChIKey | ZVKFNNQMGCVFAQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.75 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|