C20H19Cl2N3O5 — CID 17212837
3-[5-[[2-(2-chloro-4-nitroanilino)ethylamino]methyl]furan-2-yl]benzoic acid;hydrochloride (PubChem CID 17212837) has the molecular formula C20H19Cl2N3O5 and a molecular weight of 452.29 g/mol. Its IUPAC name is 3-[5-[[2-(2-chloro-4-nitroanilino)ethylamino]methyl]furan-2-yl]benzoic acid;hydrochloride.
| Compound Name | 3-[5-[[2-(2-chloro-4-nitroanilino)ethylamino]methyl]furan-2-yl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 17212837 |
| Molecular Formula | C20H19Cl2N3O5 |
| Molecular Weight | 452.29 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 3-[5-[[2-(2-chloro-4-nitroanilino)ethylamino]methyl]furan-2-yl]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1cccc(-c2ccc(CNCCNc3ccc([N+](=O)[O-])cc3Cl)o2)c1 |
| InChI | InChI=1S/C20H18ClN3O5.ClH/c21-17-11-15(24(27)28)4-6-18(17)23-9-8-22-12-16-5-7-19(29-16)13-2-1-3-14(10-13)20(25)26;/h1-7,10-11,22-23H,8-9,12H2,(H,25,26);1H |
| InChIKey | NYMHKJYSEXVUJO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.29 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|