methyl N-[(3,5-dichloro-2-methoxyphenyl)methyl]carbamate

C10H11Cl2NO3 — CID 110782986

IUPACmethyl N-[(3,5-dichloro-2-methoxyphenyl)methyl]carbamate
SMILESCOC(=O)NCc1cc(Cl)cc(Cl)c1OC
InChIInChI=1S/C10H11Cl2NO3/c1-15-9-6(5-13-10(14)16-2)3-7(11)4-8(9)12/h3-4H,5H2,1-2H3,(H,13,14)
InChIKeyRVLIAWXXSDQHSP-UHFFFAOYSA-N
MW264.11 g/mol
LogP2.86
Rot. Bonds3

About methyl N-[(3,5-dichloro-2-methoxyphenyl)methyl]carbamate

methyl N-[(3,5-dichloro-2-methoxyphenyl)methyl]carbamate (PubChem CID 110782986) has the molecular formula C10H11Cl2NO3 and a molecular weight of 264.11 g/mol. Its IUPAC name is methyl N-[(3,5-dichloro-2-methoxyphenyl)methyl]carbamate.

Molecular Properties

Compound Namemethyl N-[(3,5-dichloro-2-methoxyphenyl)methyl]carbamate
PubChem CID110782986
Molecular FormulaC10H11Cl2NO3
Molecular Weight264.11 g/mol
Exact Mass263.01
IUPAC Namemethyl N-[(3,5-dichloro-2-methoxyphenyl)methyl]carbamate
SMILESCOC(=O)NCc1cc(Cl)cc(Cl)c1OC
InChIInChI=1S/C10H11Cl2NO3/c1-15-9-6(5-13-10(14)16-2)3-7(11)4-8(9)12/h3-4H,5H2,1-2H3,(H,13,14)
InChIKeyRVLIAWXXSDQHSP-UHFFFAOYSA-N
XLogP2.86
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.11
LogP ≤ 52.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl N-[(3,5-dichloro-2-methoxyphenyl)methyl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-[(3,5-dichloro-2-methoxyphenyl)methyl]carbamate?
The IUPAC name of methyl N-[(3,5-dichloro-2-methoxyphenyl)methyl]carbamate (CID 110782986) is methyl N-[(3,5-dichloro-2-methoxyphenyl)methyl]carbamate.
What is the SMILES notation for methyl N-[(3,5-dichloro-2-methoxyphenyl)methyl]carbamate?
The canonical SMILES for methyl N-[(3,5-dichloro-2-methoxyphenyl)methyl]carbamate is COC(=O)NCc1cc(Cl)cc(Cl)c1OC.
What is the InChIKey of methyl N-[(3,5-dichloro-2-methoxyphenyl)methyl]carbamate?
The InChIKey is RVLIAWXXSDQHSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl2NO3/c1-15-9-6(5-13-10(14)16-2)3-7(11)4-8(9)12/h3-4H,5H2,1-2H3,(H,13,14).
What are the key properties of methyl N-[(3,5-dichloro-2-methoxyphenyl)methyl]carbamate?
methyl N-[(3,5-dichloro-2-methoxyphenyl)methyl]carbamate has a molecular weight of 264.11 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(3,5-dichloro-2-methoxyphenyl)methyl]carbamate is sourced from PubChem (CID 110782986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).