C10H10BrCl2NO2 — CID 115193935
N-[2-(3,5-dichloro-2-methoxyphenyl)ethyl]carbamoyl bromide (PubChem CID 115193935) has the molecular formula C10H10BrCl2NO2 and a molecular weight of 327.01 g/mol. Its IUPAC name is N-[2-(3,5-dichloro-2-methoxyphenyl)ethyl]carbamoyl bromide.
| Compound Name | N-[2-(3,5-dichloro-2-methoxyphenyl)ethyl]carbamoyl bromide |
|---|---|
| PubChem CID | 115193935 |
| Molecular Formula | C10H10BrCl2NO2 |
| Molecular Weight | 327.01 g/mol |
| Exact Mass | 324.93 |
| IUPAC Name | N-[2-(3,5-dichloro-2-methoxyphenyl)ethyl]carbamoyl bromide |
| SMILES | COc1c(Cl)cc(Cl)cc1CCNC(=O)Br |
| InChI | InChI=1S/C10H10BrCl2NO2/c1-16-9-6(2-3-14-10(11)15)4-7(12)5-8(9)13/h4-5H,2-3H2,1H3,(H,14,15) |
| InChIKey | COCYHXQIKUWOCM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.01 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|