C9H9BrCl2O — CID 82489523
1-(2-bromoethyl)-3,5-dichloro-2-methoxybenzene (PubChem CID 82489523) has the molecular formula C9H9BrCl2O and a molecular weight of 283.98 g/mol. Its IUPAC name is 1-(2-bromoethyl)-3,5-dichloro-2-methoxybenzene.
| Compound Name | 1-(2-bromoethyl)-3,5-dichloro-2-methoxybenzene |
|---|---|
| PubChem CID | 82489523 |
| Molecular Formula | C9H9BrCl2O |
| Molecular Weight | 283.98 g/mol |
| Exact Mass | 281.92 |
| IUPAC Name | 1-(2-bromoethyl)-3,5-dichloro-2-methoxybenzene |
| SMILES | COc1c(Cl)cc(Cl)cc1CCBr |
| InChI | InChI=1S/C9H9BrCl2O/c1-13-9-6(2-3-10)4-7(11)5-8(9)12/h4-5H,2-3H2,1H3 |
| InChIKey | XESMQLHZIRNFBE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.98 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|