C10H14Cl2N2O — CID 115226065
N'-[2-(3,5-dichloro-2-methoxyphenyl)ethyl]methanediamine (PubChem CID 115226065) has the molecular formula C10H14Cl2N2O and a molecular weight of 249.14 g/mol. Its IUPAC name is N'-[2-(3,5-dichloro-2-methoxyphenyl)ethyl]methanediamine.
| Compound Name | N'-[2-(3,5-dichloro-2-methoxyphenyl)ethyl]methanediamine |
|---|---|
| PubChem CID | 115226065 |
| Molecular Formula | C10H14Cl2N2O |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | N'-[2-(3,5-dichloro-2-methoxyphenyl)ethyl]methanediamine |
| SMILES | COc1c(Cl)cc(Cl)cc1CCNCN |
| InChI | InChI=1S/C10H14Cl2N2O/c1-15-10-7(2-3-14-6-13)4-8(11)5-9(10)12/h4-5,14H,2-3,6,13H2,1H3 |
| InChIKey | ZJRBAGZGTXACEQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|