C11H10Cl2O3 — CID 116866031
(E)-4-(3,5-dichloro-2-methoxyphenyl)but-2-enoic acid (PubChem CID 116866031) has the molecular formula C11H10Cl2O3 and a molecular weight of 261.10 g/mol. Its IUPAC name is (E)-4-(3,5-dichloro-2-methoxyphenyl)but-2-enoic acid.
| Compound Name | (E)-4-(3,5-dichloro-2-methoxyphenyl)but-2-enoic acid |
|---|---|
| PubChem CID | 116866031 |
| Molecular Formula | C11H10Cl2O3 |
| Molecular Weight | 261.10 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | (E)-4-(3,5-dichloro-2-methoxyphenyl)but-2-enoic acid |
| SMILES | COc1c(Cl)cc(Cl)cc1C/C=C/C(=O)O |
| InChI | InChI=1S/C11H10Cl2O3/c1-16-11-7(3-2-4-10(14)15)5-8(12)6-9(11)13/h2,4-6H,3H2,1H3,(H,14,15)/b4-2+ |
| InChIKey | DTLLHXXWDWWLKP-DUXPYHPUSA-N |
| XLogP | 3.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.10 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|