C12H14Cl2O3 — CID 83969938
3-chloro-4-(4-chloro-2,5-dimethoxyphenyl)butan-2-one (PubChem CID 83969938) has the molecular formula C12H14Cl2O3 and a molecular weight of 277.15 g/mol. Its IUPAC name is 3-chloro-4-(4-chloro-2,5-dimethoxyphenyl)butan-2-one.
| Compound Name | 3-chloro-4-(4-chloro-2,5-dimethoxyphenyl)butan-2-one |
|---|---|
| PubChem CID | 83969938 |
| Molecular Formula | C12H14Cl2O3 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 3-chloro-4-(4-chloro-2,5-dimethoxyphenyl)butan-2-one |
| SMILES | COc1cc(CC(Cl)C(C)=O)c(OC)cc1Cl |
| InChI | InChI=1S/C12H14Cl2O3/c1-7(15)9(13)4-8-5-12(17-3)10(14)6-11(8)16-2/h5-6,9H,4H2,1-3H3 |
| InChIKey | CZTNSMVJDRDAMO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|