C45H71NO5 — CID 91971416
2-[[3,4,5-tris[(3S)-3,7-dimethyloctoxy]phenyl]methyl]isoindole-1,3-dione (PubChem CID 91971416) has the molecular formula C45H71NO5 and a molecular weight of 706.07 g/mol. Its IUPAC name is 2-[[3,4,5-tris[(3S)-3,7-dimethyloctoxy]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3,4,5-tris[(3S)-3,7-dimethyloctoxy]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91971416 |
| Molecular Formula | C45H71NO5 |
| Molecular Weight | 706.07 g/mol |
| Exact Mass | 705.53 |
| IUPAC Name | 2-[[3,4,5-tris[(3S)-3,7-dimethyloctoxy]phenyl]methyl]isoindole-1,3-dione |
| SMILES | CC(C)CCC[C@H](C)CCOc1cc(CN2C(=O)c3ccccc3C2=O)cc(OCC[C@@H](C)CCCC(C)C)c1OCC[C@@H](C)CCCC(C)C |
| InChI | InChI=1S/C45H71NO5/c1-32(2)15-12-18-35(7)23-26-49-41-29-38(31-46-44(47)39-21-10-11-22-40(39)45(46)48)30-42(50-27-24-36(8)19-13-16-33(3)4)43(41)51-28-25-37(9)20-14-17-34(5)6/h10-11,21-22,29-30,32-37H,12-20,23-28,31H2,1-9H3/t35-,36-,37-/m0/s1 |
| InChIKey | QGJVJVXHXBOZJI-FSEITFBQSA-N |
| XLogP | 12.18 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.07 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|