C24H28N2O5 — CID 55725283
3-(1,3-dioxoisoindol-2-yl)-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methyl]propanamide (PubChem CID 55725283) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methyl]propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 55725283 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methyl]propanamide |
| SMILES | COc1cc(CNC(=O)CCN2C(=O)c3ccccc3C2=O)ccc1OCCC(C)C |
| InChI | InChI=1S/C24H28N2O5/c1-16(2)11-13-31-20-9-8-17(14-21(20)30-3)15-25-22(27)10-12-26-23(28)18-6-4-5-7-19(18)24(26)29/h4-9,14,16H,10-13,15H2,1-3H3,(H,25,27) |
| InChIKey | PPMICBDMYZHYLX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|