C30H33N3O4S — CID 10673807
1-[(4-tert-butylphenyl)methyl]-3-[[4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-methoxyphenyl]methyl]thiourea (PubChem CID 10673807) has the molecular formula C30H33N3O4S and a molecular weight of 531.68 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-3-[[4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-methoxyphenyl]methyl]thiourea.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-3-[[4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-methoxyphenyl]methyl]thiourea |
|---|---|
| PubChem CID | 10673807 |
| Molecular Formula | C30H33N3O4S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-3-[[4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-methoxyphenyl]methyl]thiourea |
| SMILES | COc1cc(CNC(=S)NCc2ccc(C(C)(C)C)cc2)ccc1OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H33N3O4S/c1-30(2,3)22-12-9-20(10-13-22)18-31-29(38)32-19-21-11-14-25(26(17-21)36-4)37-16-15-33-27(34)23-7-5-6-8-24(23)28(33)35/h5-14,17H,15-16,18-19H2,1-4H3,(H2,31,32,38) |
| InChIKey | MEYFOZWEHOKYGS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|