C28H28N2O6 — CID 55659737
5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxy-N-[(4-ethoxy-3-methoxyphenyl)methyl]benzamide (PubChem CID 55659737) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxy-N-[(4-ethoxy-3-methoxyphenyl)methyl]benzamide.
| Compound Name | 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxy-N-[(4-ethoxy-3-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 55659737 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-ethoxy-N-[(4-ethoxy-3-methoxyphenyl)methyl]benzamide |
| SMILES | CCOc1ccc(CNC(=O)c2cc(CN3C(=O)c4ccccc4C3=O)ccc2OCC)cc1OC |
| InChI | InChI=1S/C28H28N2O6/c1-4-35-23-12-11-19(17-30-27(32)20-8-6-7-9-21(20)28(30)33)14-22(23)26(31)29-16-18-10-13-24(36-5-2)25(15-18)34-3/h6-15H,4-5,16-17H2,1-3H3,(H,29,31) |
| InChIKey | FIIADMVUDTUOKU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|