C23H21N5O4 — CID 55722025
5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-[2-(pyrimidin-2-ylamino)ethyl]benzamide (PubChem CID 55722025) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-[2-(pyrimidin-2-ylamino)ethyl]benzamide.
| Compound Name | 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-[2-(pyrimidin-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 55722025 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-[2-(pyrimidin-2-ylamino)ethyl]benzamide |
| SMILES | COc1ccc(CN2C(=O)c3ccccc3C2=O)cc1C(=O)NCCNc1ncccn1 |
| InChI | InChI=1S/C23H21N5O4/c1-32-19-8-7-15(14-28-21(30)16-5-2-3-6-17(16)22(28)31)13-18(19)20(29)24-11-12-27-23-25-9-4-10-26-23/h2-10,13H,11-12,14H2,1H3,(H,24,29)(H,25,26,27) |
| InChIKey | NPINUMYYXIRCRH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|