C28H26N4O4 — CID 55340080
5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-[3-(2-methylbenzimidazol-1-yl)propyl]benzamide (PubChem CID 55340080) has the molecular formula C28H26N4O4 and a molecular weight of 482.54 g/mol. Its IUPAC name is 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-[3-(2-methylbenzimidazol-1-yl)propyl]benzamide.
| Compound Name | 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-[3-(2-methylbenzimidazol-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 55340080 |
| Molecular Formula | C28H26N4O4 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-[3-(2-methylbenzimidazol-1-yl)propyl]benzamide |
| SMILES | COc1ccc(CN2C(=O)c3ccccc3C2=O)cc1C(=O)NCCCn1c(C)nc2ccccc21 |
| InChI | InChI=1S/C28H26N4O4/c1-18-30-23-10-5-6-11-24(23)31(18)15-7-14-29-26(33)22-16-19(12-13-25(22)36-2)17-32-27(34)20-8-3-4-9-21(20)28(32)35/h3-6,8-13,16H,7,14-15,17H2,1-2H3,(H,29,33) |
| InChIKey | ODDKVFOQWMZWSG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|