C27H26N2O5 — CID 41365655
5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-(3-phenylmethoxypropyl)benzamide (PubChem CID 41365655) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-(3-phenylmethoxypropyl)benzamide.
| Compound Name | 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-(3-phenylmethoxypropyl)benzamide |
|---|---|
| PubChem CID | 41365655 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxy-N-(3-phenylmethoxypropyl)benzamide |
| SMILES | COc1ccc(CN2C(=O)c3ccccc3C2=O)cc1C(=O)NCCCOCc1ccccc1 |
| InChI | InChI=1S/C27H26N2O5/c1-33-24-13-12-20(17-29-26(31)21-10-5-6-11-22(21)27(29)32)16-23(24)25(30)28-14-7-15-34-18-19-8-3-2-4-9-19/h2-6,8-13,16H,7,14-15,17-18H2,1H3,(H,28,30) |
| InChIKey | MURQKTFBOAHPCM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|