C31H34N4O5 — CID 10816319
N-[(3,4-dimethoxyphenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-2-(4-phenylpiperazin-1-yl)butanamide (PubChem CID 10816319) has the molecular formula C31H34N4O5 and a molecular weight of 542.64 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-2-(4-phenylpiperazin-1-yl)butanamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-2-(4-phenylpiperazin-1-yl)butanamide |
|---|---|
| PubChem CID | 10816319 |
| Molecular Formula | C31H34N4O5 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-2-(4-phenylpiperazin-1-yl)butanamide |
| SMILES | COc1ccc(CNC(=O)C(CCN2C(=O)c3ccccc3C2=O)N2CCN(c3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C31H34N4O5/c1-39-27-13-12-22(20-28(27)40-2)21-32-29(36)26(34-18-16-33(17-19-34)23-8-4-3-5-9-23)14-15-35-30(37)24-10-6-7-11-25(24)31(35)38/h3-13,20,26H,14-19,21H2,1-2H3,(H,32,36) |
| InChIKey | QOEZNRRUUBOOSV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|