C22H31ClN2O3 — CID 120588377
2-amino-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methyl]-2-phenylpropanamide;hydrochloride (PubChem CID 120588377) has the molecular formula C22H31ClN2O3 and a molecular weight of 406.95 g/mol. Its IUPAC name is 2-amino-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methyl]-2-phenylpropanamide;hydrochloride.
| Compound Name | 2-amino-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methyl]-2-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 120588377 |
| Molecular Formula | C22H31ClN2O3 |
| Molecular Weight | 406.95 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 2-amino-N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methyl]-2-phenylpropanamide;hydrochloride |
| SMILES | COc1cc(CNC(=O)C(C)(N)c2ccccc2)ccc1OCCC(C)C.Cl |
| InChI | InChI=1S/C22H30N2O3.ClH/c1-16(2)12-13-27-19-11-10-17(14-20(19)26-4)15-24-21(25)22(3,23)18-8-6-5-7-9-18;/h5-11,14,16H,12-13,15,23H2,1-4H3,(H,24,25);1H |
| InChIKey | GEBNIBSBUJBMNA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.95 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |