C19H25ClN2O3 — CID 120592099
2-amino-N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-phenylpropanamide;hydrochloride (PubChem CID 120592099) has the molecular formula C19H25ClN2O3 and a molecular weight of 364.87 g/mol. Its IUPAC name is 2-amino-N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-phenylpropanamide;hydrochloride.
| Compound Name | 2-amino-N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 120592099 |
| Molecular Formula | C19H25ClN2O3 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-amino-N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-phenylpropanamide;hydrochloride |
| SMILES | CCOc1cc(CNC(=O)C(C)(N)c2ccccc2)ccc1OC.Cl |
| InChI | InChI=1S/C19H24N2O3.ClH/c1-4-24-17-12-14(10-11-16(17)23-3)13-21-18(22)19(2,20)15-8-6-5-7-9-15;/h5-12H,4,13,20H2,1-3H3,(H,21,22);1H |
| InChIKey | HINYYPAOOBDYOG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |