C19H27ClO4 — CID 514066
4-[6-(2-chloro-4-hydroxyphenoxy)hexyl]heptane-3,5-dione (PubChem CID 514066) has the molecular formula C19H27ClO4 and a molecular weight of 354.87 g/mol. Its IUPAC name is 4-[6-(2-chloro-4-hydroxyphenoxy)hexyl]heptane-3,5-dione.
| Compound Name | 4-[6-(2-chloro-4-hydroxyphenoxy)hexyl]heptane-3,5-dione |
|---|---|
| PubChem CID | 514066 |
| Molecular Formula | C19H27ClO4 |
| Molecular Weight | 354.87 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4-[6-(2-chloro-4-hydroxyphenoxy)hexyl]heptane-3,5-dione |
| SMILES | CCC(=O)C(CCCCCCOc1ccc(O)cc1Cl)C(=O)CC |
| InChI | InChI=1S/C19H27ClO4/c1-3-17(22)15(18(23)4-2)9-7-5-6-8-12-24-19-11-10-14(21)13-16(19)20/h10-11,13,15,21H,3-9,12H2,1-2H3 |
| InChIKey | OQZBLYDKNBBFRA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.87 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|