C18H25ClO5 — CID 70611457
2-acetyl-9-(2-chloro-4-methoxyphenoxy)nonanoic acid (PubChem CID 70611457) has the molecular formula C18H25ClO5 and a molecular weight of 356.85 g/mol. Its IUPAC name is 2-acetyl-9-(2-chloro-4-methoxyphenoxy)nonanoic acid.
| Compound Name | 2-acetyl-9-(2-chloro-4-methoxyphenoxy)nonanoic acid |
|---|---|
| PubChem CID | 70611457 |
| Molecular Formula | C18H25ClO5 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-acetyl-9-(2-chloro-4-methoxyphenoxy)nonanoic acid |
| SMILES | COc1ccc(OCCCCCCCC(C(C)=O)C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C18H25ClO5/c1-13(20)15(18(21)22)8-6-4-3-5-7-11-24-17-10-9-14(23-2)12-16(17)19/h9-10,12,15H,3-8,11H2,1-2H3,(H,21,22) |
| InChIKey | DJPXXDPDRYVLDL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|