C19H28O3 — CID 514325
4-[6-(3-hydroxyphenyl)hexyl]heptane-3,5-dione (PubChem CID 514325) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is 4-[6-(3-hydroxyphenyl)hexyl]heptane-3,5-dione.
| Compound Name | 4-[6-(3-hydroxyphenyl)hexyl]heptane-3,5-dione |
|---|---|
| PubChem CID | 514325 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 4-[6-(3-hydroxyphenyl)hexyl]heptane-3,5-dione |
| SMILES | CCC(=O)C(CCCCCCc1cccc(O)c1)C(=O)CC |
| InChI | InChI=1S/C19H28O3/c1-3-18(21)17(19(22)4-2)13-8-6-5-7-10-15-11-9-12-16(20)14-15/h9,11-12,14,17,20H,3-8,10,13H2,1-2H3 |
| InChIKey | RFXXNYDWAJLAEP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|