C24H38FNO4S — CID 58143839
1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-ethyl-2-fluorophenyl]-7-propan-2-ylsulfonylheptan-2-one (PubChem CID 58143839) has the molecular formula C24H38FNO4S and a molecular weight of 455.64 g/mol. Its IUPAC name is 1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-ethyl-2-fluorophenyl]-7-propan-2-ylsulfonylheptan-2-one.
| Compound Name | 1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-ethyl-2-fluorophenyl]-7-propan-2-ylsulfonylheptan-2-one |
|---|---|
| PubChem CID | 58143839 |
| Molecular Formula | C24H38FNO4S |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 1-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-ethyl-2-fluorophenyl]-7-propan-2-ylsulfonylheptan-2-one |
| SMILES | CCc1c(N2C[C@@H](C)O[C@@H](C)C2)ccc(CC(=O)CCCCCS(=O)(=O)C(C)C)c1F |
| InChI | InChI=1S/C24H38FNO4S/c1-6-22-23(26-15-18(4)30-19(5)16-26)12-11-20(24(22)25)14-21(27)10-8-7-9-13-31(28,29)17(2)3/h11-12,17-19H,6-10,13-16H2,1-5H3/t18-,19+ |
| InChIKey | ONBWJVVIVPQBPX-KDURUIRLSA-N |
| XLogP | 4.50 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|