About 2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide
2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide (PubChem CID 70939637) has the molecular formula C15H23F3N2O2S
and a molecular weight of 352.42 g/mol. Its IUPAC name is 2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide.
Molecular Properties
| Compound Name | 2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide |
| PubChem CID | 70939637 |
| Molecular Formula | C15H23F3N2O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)NCCCCCNc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C15H23F3N2O2S/c1-15(2,3)23(21,22)20-8-6-4-5-7-19-14-12(17)9-11(16)10-13(14)18/h9-10,19-20H,4-8H2,1-3H3 |
| InChIKey | UZXXFVVDVACCSV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide?
The IUPAC name of 2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide (CID 70939637) is 2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide.
What is the SMILES notation for 2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide?
The canonical SMILES for 2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide is CC(C)(C)S(=O)(=O)NCCCCCNc1c(F)cc(F)cc1F.
What is the InChIKey of 2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide?
The InChIKey is UZXXFVVDVACCSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23F3N2O2S/c1-15(2,3)23(21,22)20-8-6-4-5-7-19-14-12(17)9-11(16)10-13(14)18/h9-10,19-20H,4-8H2,1-3H3.
What are the key properties of 2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide?
2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide has a molecular weight of 352.42 g/mol, XLogP of 3.40, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide is sourced from PubChem (CID 70939637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).