C15H23F3N2O2S — CID 70939637
2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide (PubChem CID 70939637) has the molecular formula C15H23F3N2O2S and a molecular weight of 352.42 g/mol. Its IUPAC name is 2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide.
| Compound Name | 2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 70939637 |
| Molecular Formula | C15H23F3N2O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-methyl-N-[5-(2,4,6-trifluoroanilino)pentyl]propane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)NCCCCCNc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C15H23F3N2O2S/c1-15(2,3)23(21,22)20-8-6-4-5-7-19-14-12(17)9-11(16)10-13(14)18/h9-10,19-20H,4-8H2,1-3H3 |
| InChIKey | UZXXFVVDVACCSV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|