C17H25F3N2O4S — CID 20629897
5-(tert-butylsulfonylamino)-N-[3-methoxy-4-(trifluoromethyl)phenyl]pentanamide (PubChem CID 20629897) has the molecular formula C17H25F3N2O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is 5-(tert-butylsulfonylamino)-N-[3-methoxy-4-(trifluoromethyl)phenyl]pentanamide.
| Compound Name | 5-(tert-butylsulfonylamino)-N-[3-methoxy-4-(trifluoromethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 20629897 |
| Molecular Formula | C17H25F3N2O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 5-(tert-butylsulfonylamino)-N-[3-methoxy-4-(trifluoromethyl)phenyl]pentanamide |
| SMILES | COc1cc(NC(=O)CCCCNS(=O)(=O)C(C)(C)C)ccc1C(F)(F)F |
| InChI | InChI=1S/C17H25F3N2O4S/c1-16(2,3)27(24,25)21-10-6-5-7-15(23)22-12-8-9-13(17(18,19)20)14(11-12)26-4/h8-9,11,21H,5-7,10H2,1-4H3,(H,22,23) |
| InChIKey | GMMSIVMOWLOWFP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|