C13H15ClF3NO2 — CID 43470712
5-chloro-N-[4-methoxy-3-(trifluoromethyl)phenyl]pentanamide (PubChem CID 43470712) has the molecular formula C13H15ClF3NO2 and a molecular weight of 309.72 g/mol. Its IUPAC name is 5-chloro-N-[4-methoxy-3-(trifluoromethyl)phenyl]pentanamide.
| Compound Name | 5-chloro-N-[4-methoxy-3-(trifluoromethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 43470712 |
| Molecular Formula | C13H15ClF3NO2 |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 5-chloro-N-[4-methoxy-3-(trifluoromethyl)phenyl]pentanamide |
| SMILES | COc1ccc(NC(=O)CCCCCl)cc1C(F)(F)F |
| InChI | InChI=1S/C13H15ClF3NO2/c1-20-11-6-5-9(8-10(11)13(15,16)17)18-12(19)4-2-3-7-14/h5-6,8H,2-4,7H2,1H3,(H,18,19) |
| InChIKey | ICLGYJMZPTWNMO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|