C14H21IN2O3 — CID 120962135
4-[[(3-iodo-4,5-dimethoxyphenyl)methylamino]methyl]pyrrolidin-3-ol (PubChem CID 120962135) has the molecular formula C14H21IN2O3 and a molecular weight of 392.24 g/mol. Its IUPAC name is 4-[[(3-iodo-4,5-dimethoxyphenyl)methylamino]methyl]pyrrolidin-3-ol.
| Compound Name | 4-[[(3-iodo-4,5-dimethoxyphenyl)methylamino]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 120962135 |
| Molecular Formula | C14H21IN2O3 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 4-[[(3-iodo-4,5-dimethoxyphenyl)methylamino]methyl]pyrrolidin-3-ol |
| SMILES | COc1cc(CNCC2CNCC2O)cc(I)c1OC |
| InChI | InChI=1S/C14H21IN2O3/c1-19-13-4-9(3-11(15)14(13)20-2)5-16-6-10-7-17-8-12(10)18/h3-4,10,12,16-18H,5-8H2,1-2H3 |
| InChIKey | KVOXQZNVBMJOPD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|