C16H27ClN2O3 — CID 120962016
4-[[(3-methoxy-4-propoxyphenyl)methylamino]methyl]pyrrolidin-3-ol;hydrochloride (PubChem CID 120962016) has the molecular formula C16H27ClN2O3 and a molecular weight of 330.86 g/mol. Its IUPAC name is 4-[[(3-methoxy-4-propoxyphenyl)methylamino]methyl]pyrrolidin-3-ol;hydrochloride.
| Compound Name | 4-[[(3-methoxy-4-propoxyphenyl)methylamino]methyl]pyrrolidin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 120962016 |
| Molecular Formula | C16H27ClN2O3 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 4-[[(3-methoxy-4-propoxyphenyl)methylamino]methyl]pyrrolidin-3-ol;hydrochloride |
| SMILES | CCCOc1ccc(CNCC2CNCC2O)cc1OC.Cl |
| InChI | InChI=1S/C16H26N2O3.ClH/c1-3-6-21-15-5-4-12(7-16(15)20-2)8-17-9-13-10-18-11-14(13)19;/h4-5,7,13-14,17-19H,3,6,8-11H2,1-2H3;1H |
| InChIKey | PYXPNISBWRVMNQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |