C17H28N2O3 — CID 120963111
4-[[(3-ethoxy-4-propoxyphenyl)methylamino]methyl]pyrrolidin-3-ol (PubChem CID 120963111) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 4-[[(3-ethoxy-4-propoxyphenyl)methylamino]methyl]pyrrolidin-3-ol.
| Compound Name | 4-[[(3-ethoxy-4-propoxyphenyl)methylamino]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 120963111 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 4-[[(3-ethoxy-4-propoxyphenyl)methylamino]methyl]pyrrolidin-3-ol |
| SMILES | CCCOc1ccc(CNCC2CNCC2O)cc1OCC |
| InChI | InChI=1S/C17H28N2O3/c1-3-7-22-16-6-5-13(8-17(16)21-4-2)9-18-10-14-11-19-12-15(14)20/h5-6,8,14-15,18-20H,3-4,7,9-12H2,1-2H3 |
| InChIKey | SSLLESTXNNEWQM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |