C15H22ClN3O4 — CID 120962121
2-[2-chloro-4-[[(4-hydroxypyrrolidin-3-yl)methylamino]methyl]-6-methoxyphenoxy]acetamide (PubChem CID 120962121) has the molecular formula C15H22ClN3O4 and a molecular weight of 343.81 g/mol. Its IUPAC name is 2-[2-chloro-4-[[(4-hydroxypyrrolidin-3-yl)methylamino]methyl]-6-methoxyphenoxy]acetamide.
| Compound Name | 2-[2-chloro-4-[[(4-hydroxypyrrolidin-3-yl)methylamino]methyl]-6-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 120962121 |
| Molecular Formula | C15H22ClN3O4 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-[2-chloro-4-[[(4-hydroxypyrrolidin-3-yl)methylamino]methyl]-6-methoxyphenoxy]acetamide |
| SMILES | COc1cc(CNCC2CNCC2O)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C15H22ClN3O4/c1-22-13-3-9(2-11(16)15(13)23-8-14(17)21)4-18-5-10-6-19-7-12(10)20/h2-3,10,12,18-20H,4-8H2,1H3,(H2,17,21) |
| InChIKey | QFTORPUUSYULSX-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |