C17H20INO2 — CID 7390001
(1S)-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-1-phenylethanamine (PubChem CID 7390001) has the molecular formula C17H20INO2 and a molecular weight of 397.26 g/mol. Its IUPAC name is (1S)-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-1-phenylethanamine.
| Compound Name | (1S)-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-1-phenylethanamine |
|---|---|
| PubChem CID | 7390001 |
| Molecular Formula | C17H20INO2 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | (1S)-N-[(3-iodo-4,5-dimethoxyphenyl)methyl]-1-phenylethanamine |
| SMILES | COc1cc(CN[C@@H](C)c2ccccc2)cc(I)c1OC |
| InChI | InChI=1S/C17H20INO2/c1-12(14-7-5-4-6-8-14)19-11-13-9-15(18)17(21-3)16(10-13)20-2/h4-10,12,19H,11H2,1-3H3/t12-/m0/s1 |
| InChIKey | RTRHYTOPLHZHEF-LBPRGKRZSA-N |
| XLogP | 4.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|