C20H27NO4 — CID 94809075
(1S)-1-(3-ethoxyphenyl)-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine (PubChem CID 94809075) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is (1S)-1-(3-ethoxyphenyl)-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine.
| Compound Name | (1S)-1-(3-ethoxyphenyl)-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 94809075 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (1S)-1-(3-ethoxyphenyl)-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine |
| SMILES | CCOc1cccc([C@H](C)NCc2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C20H27NO4/c1-6-25-17-9-7-8-16(12-17)14(2)21-13-15-10-18(22-3)20(24-5)19(11-15)23-4/h7-12,14,21H,6,13H2,1-5H3/t14-/m0/s1 |
| InChIKey | DCWSVYWBEOFZRE-AWEZNQCLSA-N |
| XLogP | 3.96 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |