C18H22BrNO3 — CID 30615952
(1R)-1-(2-bromophenyl)-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine (PubChem CID 30615952) has the molecular formula C18H22BrNO3 and a molecular weight of 380.28 g/mol. Its IUPAC name is (1R)-1-(2-bromophenyl)-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine.
| Compound Name | (1R)-1-(2-bromophenyl)-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 30615952 |
| Molecular Formula | C18H22BrNO3 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | (1R)-1-(2-bromophenyl)-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine |
| SMILES | COc1cc(CN[C@H](C)c2ccccc2Br)cc(OC)c1OC |
| InChI | InChI=1S/C18H22BrNO3/c1-12(14-7-5-6-8-15(14)19)20-11-13-9-16(21-2)18(23-4)17(10-13)22-3/h5-10,12,20H,11H2,1-4H3/t12-/m1/s1 |
| InChIKey | NNICDQMUHIQTJK-GFCCVEGCSA-N |
| XLogP | 4.33 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |