C17H22N2O3 — CID 47008253
1-pyridin-2-yl-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine (PubChem CID 47008253) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 1-pyridin-2-yl-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine.
| Compound Name | 1-pyridin-2-yl-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 47008253 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-pyridin-2-yl-N-[(3,4,5-trimethoxyphenyl)methyl]ethanamine |
| SMILES | COc1cc(CNC(C)c2ccccn2)cc(OC)c1OC |
| InChI | InChI=1S/C17H22N2O3/c1-12(14-7-5-6-8-18-14)19-11-13-9-15(20-2)17(22-4)16(10-13)21-3/h5-10,12,19H,11H2,1-4H3 |
| InChIKey | NNFJPSRVWARJTQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |