C14H20INO4 — CID 122043863
2-[(3-iodo-4,5-dimethoxyphenyl)methyl-propan-2-ylamino]acetic acid (PubChem CID 122043863) has the molecular formula C14H20INO4 and a molecular weight of 393.22 g/mol. Its IUPAC name is 2-[(3-iodo-4,5-dimethoxyphenyl)methyl-propan-2-ylamino]acetic acid.
| Compound Name | 2-[(3-iodo-4,5-dimethoxyphenyl)methyl-propan-2-ylamino]acetic acid |
|---|---|
| PubChem CID | 122043863 |
| Molecular Formula | C14H20INO4 |
| Molecular Weight | 393.22 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 2-[(3-iodo-4,5-dimethoxyphenyl)methyl-propan-2-ylamino]acetic acid |
| SMILES | COc1cc(CN(CC(=O)O)C(C)C)cc(I)c1OC |
| InChI | InChI=1S/C14H20INO4/c1-9(2)16(8-13(17)18)7-10-5-11(15)14(20-4)12(6-10)19-3/h5-6,9H,7-8H2,1-4H3,(H,17,18) |
| InChIKey | DONYSOCMBGKWLL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.22 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|