C14H20ClNO4 — CID 122043927
2-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methyl-propan-2-ylamino]acetic acid (PubChem CID 122043927) has the molecular formula C14H20ClNO4 and a molecular weight of 301.77 g/mol. Its IUPAC name is 2-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methyl-propan-2-ylamino]acetic acid.
| Compound Name | 2-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methyl-propan-2-ylamino]acetic acid |
|---|---|
| PubChem CID | 122043927 |
| Molecular Formula | C14H20ClNO4 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methyl-propan-2-ylamino]acetic acid |
| SMILES | CCOc1cc(CN(CC(=O)O)C(C)C)cc(Cl)c1O |
| InChI | InChI=1S/C14H20ClNO4/c1-4-20-12-6-10(5-11(15)14(12)19)7-16(9(2)3)8-13(17)18/h5-6,9,19H,4,7-8H2,1-3H3,(H,17,18) |
| InChIKey | UABIUDDWHCWDHB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |