C17H16ClFO4 — CID 83953274
3-(3-chloro-5-ethoxy-4-hydroxyphenyl)-2-(4-fluorophenyl)propanoic acid (PubChem CID 83953274) has the molecular formula C17H16ClFO4 and a molecular weight of 338.76 g/mol. Its IUPAC name is 3-(3-chloro-5-ethoxy-4-hydroxyphenyl)-2-(4-fluorophenyl)propanoic acid.
| Compound Name | 3-(3-chloro-5-ethoxy-4-hydroxyphenyl)-2-(4-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 83953274 |
| Molecular Formula | C17H16ClFO4 |
| Molecular Weight | 338.76 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 3-(3-chloro-5-ethoxy-4-hydroxyphenyl)-2-(4-fluorophenyl)propanoic acid |
| SMILES | CCOc1cc(CC(C(=O)O)c2ccc(F)cc2)cc(Cl)c1O |
| InChI | InChI=1S/C17H16ClFO4/c1-2-23-15-9-10(8-14(18)16(15)20)7-13(17(21)22)11-3-5-12(19)6-4-11/h3-6,8-9,13,20H,2,7H2,1H3,(H,21,22) |
| InChIKey | YRVRBYDTEGTLKX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.76 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |