C12H18ClNO3 — CID 83977198
4-[2-(aminomethyl)-3-hydroxypropyl]-2-chloro-6-ethoxyphenol (PubChem CID 83977198) has the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. Its IUPAC name is 4-[2-(aminomethyl)-3-hydroxypropyl]-2-chloro-6-ethoxyphenol.
| Compound Name | 4-[2-(aminomethyl)-3-hydroxypropyl]-2-chloro-6-ethoxyphenol |
|---|---|
| PubChem CID | 83977198 |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 4-[2-(aminomethyl)-3-hydroxypropyl]-2-chloro-6-ethoxyphenol |
| SMILES | CCOc1cc(CC(CN)CO)cc(Cl)c1O |
| InChI | InChI=1S/C12H18ClNO3/c1-2-17-11-5-8(3-9(6-14)7-15)4-10(13)12(11)16/h4-5,9,15-16H,2-3,6-7,14H2,1H3 |
| InChIKey | HGEDLUIRDGWVST-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |