C13H17Cl2NO2 — CID 65057535
2-[butan-2-yl-[(3,5-dichlorophenyl)methyl]amino]acetic acid (PubChem CID 65057535) has the molecular formula C13H17Cl2NO2 and a molecular weight of 290.19 g/mol. Its IUPAC name is 2-[butan-2-yl-[(3,5-dichlorophenyl)methyl]amino]acetic acid.
| Compound Name | 2-[butan-2-yl-[(3,5-dichlorophenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 65057535 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-[butan-2-yl-[(3,5-dichlorophenyl)methyl]amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2NO2/c1-3-9(2)16(8-13(17)18)7-10-4-11(14)6-12(15)5-10/h4-6,9H,3,7-8H2,1-2H3,(H,17,18) |
| InChIKey | CGPAJCYXXRTWOJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |