C14H19Cl2NO3 — CID 60833285
2-[butan-2-yl-[2-(2,4-dichlorophenoxy)ethyl]amino]acetic acid (PubChem CID 60833285) has the molecular formula C14H19Cl2NO3 and a molecular weight of 320.22 g/mol. Its IUPAC name is 2-[butan-2-yl-[2-(2,4-dichlorophenoxy)ethyl]amino]acetic acid.
| Compound Name | 2-[butan-2-yl-[2-(2,4-dichlorophenoxy)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 60833285 |
| Molecular Formula | C14H19Cl2NO3 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-[butan-2-yl-[2-(2,4-dichlorophenoxy)ethyl]amino]acetic acid |
| SMILES | CCC(C)N(CCOc1ccc(Cl)cc1Cl)CC(=O)O |
| InChI | InChI=1S/C14H19Cl2NO3/c1-3-10(2)17(9-14(18)19)6-7-20-13-5-4-11(15)8-12(13)16/h4-5,8,10H,3,6-7,9H2,1-2H3,(H,18,19) |
| InChIKey | LNIXQHSAPLFSBJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |