C13H19Cl2NO2 — CID 60691948
2-[2-(2,4-dichlorophenoxy)ethyl-propan-2-ylamino]ethanol (PubChem CID 60691948) has the molecular formula C13H19Cl2NO2 and a molecular weight of 292.21 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenoxy)ethyl-propan-2-ylamino]ethanol.
| Compound Name | 2-[2-(2,4-dichlorophenoxy)ethyl-propan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 60691948 |
| Molecular Formula | C13H19Cl2NO2 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-[2-(2,4-dichlorophenoxy)ethyl-propan-2-ylamino]ethanol |
| SMILES | CC(C)N(CCO)CCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H19Cl2NO2/c1-10(2)16(5-7-17)6-8-18-13-4-3-11(14)9-12(13)15/h3-4,9-10,17H,5-8H2,1-2H3 |
| InChIKey | RDVLWKUKKNTXBY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |