C13H18BrClN2 — CID 83230226
1-[(3-bromo-4-chlorophenyl)methyl]-5-methylpiperidin-3-amine (PubChem CID 83230226) has the molecular formula C13H18BrClN2 and a molecular weight of 317.66 g/mol. Its IUPAC name is 1-[(3-bromo-4-chlorophenyl)methyl]-5-methylpiperidin-3-amine.
| Compound Name | 1-[(3-bromo-4-chlorophenyl)methyl]-5-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 83230226 |
| Molecular Formula | C13H18BrClN2 |
| Molecular Weight | 317.66 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 1-[(3-bromo-4-chlorophenyl)methyl]-5-methylpiperidin-3-amine |
| SMILES | CC1CC(N)CN(Cc2ccc(Cl)c(Br)c2)C1 |
| InChI | InChI=1S/C13H18BrClN2/c1-9-4-11(16)8-17(6-9)7-10-2-3-13(15)12(14)5-10/h2-3,5,9,11H,4,6-8,16H2,1H3 |
| InChIKey | XBOYKGVPUSXBTC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.66 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |