C21H27ClF2N2 — CID 120840968
1-[1-[2,2-bis(4-fluorophenyl)ethyl]piperidin-3-yl]ethanamine;hydrochloride (PubChem CID 120840968) has the molecular formula C21H27ClF2N2 and a molecular weight of 380.91 g/mol. Its IUPAC name is 1-[1-[2,2-bis(4-fluorophenyl)ethyl]piperidin-3-yl]ethanamine;hydrochloride.
| Compound Name | 1-[1-[2,2-bis(4-fluorophenyl)ethyl]piperidin-3-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 120840968 |
| Molecular Formula | C21H27ClF2N2 |
| Molecular Weight | 380.91 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-[1-[2,2-bis(4-fluorophenyl)ethyl]piperidin-3-yl]ethanamine;hydrochloride |
| SMILES | CC(N)C1CCCN(CC(c2ccc(F)cc2)c2ccc(F)cc2)C1.Cl |
| InChI | InChI=1S/C21H26F2N2.ClH/c1-15(24)18-3-2-12-25(13-18)14-21(16-4-8-19(22)9-5-16)17-6-10-20(23)11-7-17;/h4-11,15,18,21H,2-3,12-14,24H2,1H3;1H |
| InChIKey | FVKYSLFGYJLAMD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.91 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |