C19H22F2N2 — CID 120834747
1-[2,2-bis(4-fluorophenyl)ethyl]piperidin-3-amine (PubChem CID 120834747) has the molecular formula C19H22F2N2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-[2,2-bis(4-fluorophenyl)ethyl]piperidin-3-amine.
| Compound Name | 1-[2,2-bis(4-fluorophenyl)ethyl]piperidin-3-amine |
|---|---|
| PubChem CID | 120834747 |
| Molecular Formula | C19H22F2N2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-[2,2-bis(4-fluorophenyl)ethyl]piperidin-3-amine |
| SMILES | NC1CCCN(CC(c2ccc(F)cc2)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H22F2N2/c20-16-7-3-14(4-8-16)19(15-5-9-17(21)10-6-15)13-23-11-1-2-18(22)12-23/h3-10,18-19H,1-2,11-13,22H2 |
| InChIKey | XUWQSOFJRUXSPN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |