C16H29ClN4 — CID 120841116
5-[[3-(1-aminoethyl)piperidin-1-yl]methyl]-N-ethyl-N-methylpyridin-2-amine;hydrochloride (PubChem CID 120841116) has the molecular formula C16H29ClN4 and a molecular weight of 312.89 g/mol. Its IUPAC name is 5-[[3-(1-aminoethyl)piperidin-1-yl]methyl]-N-ethyl-N-methylpyridin-2-amine;hydrochloride.
| Compound Name | 5-[[3-(1-aminoethyl)piperidin-1-yl]methyl]-N-ethyl-N-methylpyridin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 120841116 |
| Molecular Formula | C16H29ClN4 |
| Molecular Weight | 312.89 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 5-[[3-(1-aminoethyl)piperidin-1-yl]methyl]-N-ethyl-N-methylpyridin-2-amine;hydrochloride |
| SMILES | CCN(C)c1ccc(CN2CCCC(C(C)N)C2)cn1.Cl |
| InChI | InChI=1S/C16H28N4.ClH/c1-4-19(3)16-8-7-14(10-18-16)11-20-9-5-6-15(12-20)13(2)17;/h7-8,10,13,15H,4-6,9,11-12,17H2,1-3H3;1H |
| InChIKey | RFUZORBOUJPCDP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.89 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |