C19H22ClFN2O2S — CID 22208104
1-[(3-chloro-4-fluorophenyl)methyl]-4-(4-ethylphenyl)sulfonylpiperazine (PubChem CID 22208104) has the molecular formula C19H22ClFN2O2S and a molecular weight of 396.92 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]-4-(4-ethylphenyl)sulfonylpiperazine.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]-4-(4-ethylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 22208104 |
| Molecular Formula | C19H22ClFN2O2S |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]-4-(4-ethylphenyl)sulfonylpiperazine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN(Cc3ccc(F)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C19H22ClFN2O2S/c1-2-15-3-6-17(7-4-15)26(24,25)23-11-9-22(10-12-23)14-16-5-8-19(21)18(20)13-16/h3-8,13H,2,9-12,14H2,1H3 |
| InChIKey | YHTLCBZEZLPEBF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |